C21H25N3O3 — CID 71889091
2-(2,6-dimethylmorpholin-4-yl)-N-[2-(N-methylanilino)phenyl]-2-oxoacetamide (PubChem CID 71889091) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-N-[2-(N-methylanilino)phenyl]-2-oxoacetamide.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-N-[2-(N-methylanilino)phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 71889091 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-N-[2-(N-methylanilino)phenyl]-2-oxoacetamide |
| SMILES | CC1CN(C(=O)C(=O)Nc2ccccc2N(C)c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C21H25N3O3/c1-15-13-24(14-16(2)27-15)21(26)20(25)22-18-11-7-8-12-19(18)23(3)17-9-5-4-6-10-17/h4-12,15-16H,13-14H2,1-3H3,(H,22,25) |
| InChIKey | DEYMZSWOOCTUPC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|