C19H26N2O5 — CID 108503933
butyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetyl]amino]benzoate (PubChem CID 108503933) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is butyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetyl]amino]benzoate.
| Compound Name | butyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108503933 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | butyl 2-[[2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)C(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C19H26N2O5/c1-4-5-10-25-19(24)15-8-6-7-9-16(15)20-17(22)18(23)21-11-13(2)26-14(3)12-21/h6-9,13-14H,4-5,10-12H2,1-3H3,(H,20,22) |
| InChIKey | HDXXFWQEEKATAB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|