C20H28N2O5 — CID 108514709
butyl 2-[[2-[2-(2-hydroxyethyl)piperidin-1-yl]-2-oxoacetyl]amino]benzoate (PubChem CID 108514709) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is butyl 2-[[2-[2-(2-hydroxyethyl)piperidin-1-yl]-2-oxoacetyl]amino]benzoate.
| Compound Name | butyl 2-[[2-[2-(2-hydroxyethyl)piperidin-1-yl]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108514709 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | butyl 2-[[2-[2-(2-hydroxyethyl)piperidin-1-yl]-2-oxoacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)C(=O)N1CCCCC1CCO |
| InChI | InChI=1S/C20H28N2O5/c1-2-3-14-27-20(26)16-9-4-5-10-17(16)21-18(24)19(25)22-12-7-6-8-15(22)11-13-23/h4-5,9-10,15,23H,2-3,6-8,11-14H2,1H3,(H,21,24) |
| InChIKey | ZVMDJXYYOFZADL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|