C22H24F3N3O6 — CID 42572797
[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone (PubChem CID 42572797) has the molecular formula C22H24F3N3O6 and a molecular weight of 483.44 g/mol. Its IUPAC name is [4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone.
| Compound Name | [4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42572797 |
| Molecular Formula | C22H24F3N3O6 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | [4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C22H24F3N3O6/c1-32-17-12-16(18(28(30)31)20(34-3)19(17)33-2)21(29)27-10-8-26(9-11-27)13-14-4-6-15(7-5-14)22(23,24)25/h4-7,12H,8-11,13H2,1-3H3 |
| InChIKey | IHMJQWHFGVDGNJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 94.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|