C21H24FN3O8S — CID 24552262
[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone (PubChem CID 24552262) has the molecular formula C21H24FN3O8S and a molecular weight of 497.50 g/mol. Its IUPAC name is [4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone.
| Compound Name | [4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 24552262 |
| Molecular Formula | C21H24FN3O8S |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | [4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-(3,4,5-trimethoxy-2-nitrophenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCCN(S(=O)(=O)c3ccc(F)cc3)CC2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C21H24FN3O8S/c1-31-17-13-16(18(25(27)28)20(33-3)19(17)32-2)21(26)23-9-4-10-24(12-11-23)34(29,30)15-7-5-14(22)6-8-15/h5-8,13H,4,9-12H2,1-3H3 |
| InChIKey | KRVHCEOOESFRTD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|