C24H23FN4O8S2 — CID 42959390
N-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]-3-hydroxyphenyl]-3-nitrobenzenesulfonamide (PubChem CID 42959390) has the molecular formula C24H23FN4O8S2 and a molecular weight of 578.60 g/mol. Its IUPAC name is N-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]-3-hydroxyphenyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]-3-hydroxyphenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 42959390 |
| Molecular Formula | C24H23FN4O8S2 |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | N-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carbonyl]-3-hydroxyphenyl]-3-nitrobenzenesulfonamide |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1O)N1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H23FN4O8S2/c25-17-5-8-20(9-6-17)39(36,37)28-12-2-11-27(13-14-28)24(31)22-10-7-18(15-23(22)30)26-38(34,35)21-4-1-3-19(16-21)29(32)33/h1,3-10,15-16,26,30H,2,11-14H2 |
| InChIKey | FTAAMBISDHDZFE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 167.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|