C22H29NO2Sn — CID 70065368
[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]-trimethylstannane (PubChem CID 70065368) has the molecular formula C22H29NO2Sn and a molecular weight of 458.19 g/mol. Its IUPAC name is [1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]-trimethylstannane.
| Compound Name | [1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]-trimethylstannane |
|---|---|
| PubChem CID | 70065368 |
| Molecular Formula | C22H29NO2Sn |
| Molecular Weight | 458.19 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | [1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]-trimethylstannane |
| SMILES | COc1ccc(C(=Cc2ccncc2)[Sn](C)(C)C)cc1OC1CCCC1 |
| InChI | InChI=1S/C19H20NO2.3CH3.Sn/c1-21-18-9-8-16(7-6-15-10-12-20-13-11-15)14-19(18)22-17-4-2-3-5-17;;;;/h6,8-14,17H,2-5H2,1H3;3*1H3; |
| InChIKey | BMJDTLBSWKEQRW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.19 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |