C15H21BrN2O — CID 23854347
1-(5-bromo-2-methoxyphenyl)-N-(2,6-dimethylpiperidin-1-yl)methanimine (PubChem CID 23854347) has the molecular formula C15H21BrN2O and a molecular weight of 325.25 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-N-(2,6-dimethylpiperidin-1-yl)methanimine.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-N-(2,6-dimethylpiperidin-1-yl)methanimine |
|---|---|
| PubChem CID | 23854347 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-N-(2,6-dimethylpiperidin-1-yl)methanimine |
| SMILES | COc1ccc(Br)cc1C=NN1C(C)CCCC1C |
| InChI | InChI=1S/C15H21BrN2O/c1-11-5-4-6-12(2)18(11)17-10-13-9-14(16)7-8-15(13)19-3/h7-12H,4-6H2,1-3H3 |
| InChIKey | VJNTYIAYFXLKCA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|