C15H20F2N2O — CID 6598140
(Z)-1-[2-(difluoromethoxy)phenyl]-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanimine (PubChem CID 6598140) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is (Z)-1-[2-(difluoromethoxy)phenyl]-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanimine.
| Compound Name | (Z)-1-[2-(difluoromethoxy)phenyl]-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanimine |
|---|---|
| PubChem CID | 6598140 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (Z)-1-[2-(difluoromethoxy)phenyl]-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanimine |
| SMILES | C[C@H]1CCC[C@H](C)N1/N=C\c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H20F2N2O/c1-11-6-5-7-12(2)19(11)18-10-13-8-3-4-9-14(13)20-15(16)17/h3-4,8-12,15H,5-7H2,1-2H3/b18-10-/t11-,12-/m0/s1 |
| InChIKey | SLCKKVHNXCAZQY-PUEUJWCZSA-N |
| XLogP | 3.88 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|