C14H16F4N2O2 — CID 6903285
(E)-1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine (PubChem CID 6903285) has the molecular formula C14H16F4N2O2 and a molecular weight of 320.29 g/mol. Its IUPAC name is (E)-1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine.
| Compound Name | (E)-1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine |
|---|---|
| PubChem CID | 6903285 |
| Molecular Formula | C14H16F4N2O2 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (E)-1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine |
| SMILES | FC(F)Oc1ccc(/C=N/N2CCCCC2)c(OC(F)F)c1 |
| InChI | InChI=1S/C14H16F4N2O2/c15-13(16)21-11-5-4-10(12(8-11)22-14(17)18)9-19-20-6-2-1-3-7-20/h4-5,8-9,13-14H,1-3,6-7H2/b19-9+ |
| InChIKey | YQEYNIKVWYQALE-DJKKODMXSA-N |
| XLogP | 3.71 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|