C22H20F4N4O2 — CID 2456166
1-[2,4-bis(difluoromethoxy)phenyl]-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]methanimine (PubChem CID 2456166) has the molecular formula C22H20F4N4O2 and a molecular weight of 448.42 g/mol. Its IUPAC name is 1-[2,4-bis(difluoromethoxy)phenyl]-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]methanimine.
| Compound Name | 1-[2,4-bis(difluoromethoxy)phenyl]-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 2456166 |
| Molecular Formula | C22H20F4N4O2 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1-[2,4-bis(difluoromethoxy)phenyl]-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]methanimine |
| SMILES | FC(F)Oc1ccc(/C=N/c2ccc(-c3nnc4n3CCCCC4)cc2)c(OC(F)F)c1 |
| InChI | InChI=1S/C22H20F4N4O2/c23-21(24)31-17-10-7-15(18(12-17)32-22(25)26)13-27-16-8-5-14(6-9-16)20-29-28-19-4-2-1-3-11-30(19)20/h5-10,12-13,21-22H,1-4,11H2/b27-13+ |
| InChIKey | HJRRDHDTRJMWDN-UVHMKAGCSA-N |
| XLogP | 5.62 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|