C16H21F2N3O2 — CID 6900597
N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-piperidin-1-ylpropanamide (PubChem CID 6900597) has the molecular formula C16H21F2N3O2 and a molecular weight of 325.36 g/mol. Its IUPAC name is N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 6900597 |
| Molecular Formula | C16H21F2N3O2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-3-piperidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCCC1)N/N=C/c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H21F2N3O2/c17-16(18)23-14-7-3-2-6-13(14)12-19-20-15(22)8-11-21-9-4-1-5-10-21/h2-3,6-7,12,16H,1,4-5,8-11H2,(H,20,22)/b19-12+ |
| InChIKey | FOXJSHRRQGCAGY-XDHOZWIPSA-N |
| XLogP | 2.61 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|