C22H27FN2O2 — CID 23878734
N-(2,6-dimethylpiperidin-1-yl)-1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine (PubChem CID 23878734) has the molecular formula C22H27FN2O2 and a molecular weight of 370.47 g/mol. Its IUPAC name is N-(2,6-dimethylpiperidin-1-yl)-1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine.
| Compound Name | N-(2,6-dimethylpiperidin-1-yl)-1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine |
|---|---|
| PubChem CID | 23878734 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N-(2,6-dimethylpiperidin-1-yl)-1-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methanimine |
| SMILES | COc1cc(C=NN2C(C)CCCC2C)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H27FN2O2/c1-16-5-4-6-17(2)25(16)24-14-19-9-12-21(22(13-19)26-3)27-15-18-7-10-20(23)11-8-18/h7-14,16-17H,4-6,15H2,1-3H3 |
| InChIKey | DRSNYIVVFJMCIP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|