C19H14ClN5OS — CID 170903101
N-[(E)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-4-pyridin-4-yl-1,3-thiazol-2-amine (PubChem CID 170903101) has the molecular formula C19H14ClN5OS and a molecular weight of 395.88 g/mol. Its IUPAC name is N-[(E)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-4-pyridin-4-yl-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-4-pyridin-4-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 170903101 |
| Molecular Formula | C19H14ClN5OS |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N-[(E)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-4-pyridin-4-yl-1,3-thiazol-2-amine |
| SMILES | COc1ccc2nc(Cl)c(/C=N/Nc3nc(-c4ccncc4)cs3)cc2c1 |
| InChI | InChI=1S/C19H14ClN5OS/c1-26-15-2-3-16-13(9-15)8-14(18(20)23-16)10-22-25-19-24-17(11-27-19)12-4-6-21-7-5-12/h2-11H,1H3,(H,24,25)/b22-10+ |
| InChIKey | JVKCECOOPPAJLS-LSHDLFTRSA-N |
| XLogP | 4.86 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|