C18H18BrN3O3S — CID 172885904
4-[2-[(2E)-2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol;hydrobromide (PubChem CID 172885904) has the molecular formula C18H18BrN3O3S and a molecular weight of 436.33 g/mol. Its IUPAC name is 4-[2-[(2E)-2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol;hydrobromide.
| Compound Name | 4-[2-[(2E)-2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol;hydrobromide |
|---|---|
| PubChem CID | 172885904 |
| Molecular Formula | C18H18BrN3O3S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 4-[2-[(2E)-2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenol;hydrobromide |
| SMILES | Br.COc1ccc(OC)c(/C=N/Nc2nc(-c3ccc(O)cc3)cs2)c1 |
| InChI | InChI=1S/C18H17N3O3S.BrH/c1-23-15-7-8-17(24-2)13(9-15)10-19-21-18-20-16(11-25-18)12-3-5-14(22)6-4-12;/h3-11,22H,1-2H3,(H,20,21);1H/b19-10+; |
| InChIKey | ZCWHJEGBFKEXSN-ZIOFAICLSA-N |
| XLogP | 4.56 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|