C24H21N3O3S2 — CID 168577489
N-[[2-(2,5-dimethoxyphenyl)sulfinylphenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168577489) has the molecular formula C24H21N3O3S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[[2-(2,5-dimethoxyphenyl)sulfinylphenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[2-(2,5-dimethoxyphenyl)sulfinylphenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577489 |
| Molecular Formula | C24H21N3O3S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | N-[[2-(2,5-dimethoxyphenyl)sulfinylphenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(OC)c(S(=O)c2ccccc2C=NNc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C24H21N3O3S2/c1-29-19-12-13-21(30-2)23(14-19)32(28)22-11-7-6-10-18(22)15-25-27-24-26-20(16-31-24)17-8-4-3-5-9-17/h3-16H,1-2H3,(H,26,27) |
| InChIKey | KTDOBJNJRFIOME-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|