C28H23ClN4O2 — CID 5161149
3-[(2-chloro-6-methylquinolin-3-yl)methylideneamino]-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazolidin-4-one (PubChem CID 5161149) has the molecular formula C28H23ClN4O2 and a molecular weight of 482.97 g/mol. Its IUPAC name is 3-[(2-chloro-6-methylquinolin-3-yl)methylideneamino]-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazolidin-4-one.
| Compound Name | 3-[(2-chloro-6-methylquinolin-3-yl)methylideneamino]-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazolidin-4-one |
|---|---|
| PubChem CID | 5161149 |
| Molecular Formula | C28H23ClN4O2 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 3-[(2-chloro-6-methylquinolin-3-yl)methylideneamino]-5-[(4-methoxyphenyl)methylidene]-2-phenylimidazolidin-4-one |
| SMILES | COc1ccc(C=C2NC(c3ccccc3)N(N=Cc3cc4cc(C)ccc4nc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C28H23ClN4O2/c1-18-8-13-24-21(14-18)16-22(26(29)31-24)17-30-33-27(20-6-4-3-5-7-20)32-25(28(33)34)15-19-9-11-23(35-2)12-10-19/h3-17,27,32H,1-2H3 |
| InChIKey | QZCHVMBIQVLPAQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|