C18H17ClN2O2 — CID 1285509
2-[(2-chloro-6-methoxyquinolin-3-yl)methylidene]-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 1285509) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-[(2-chloro-6-methoxyquinolin-3-yl)methylidene]-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | 2-[(2-chloro-6-methoxyquinolin-3-yl)methylidene]-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 1285509 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-[(2-chloro-6-methoxyquinolin-3-yl)methylidene]-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | COc1ccc2nc(Cl)c(C=C(C#N)C(=O)C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C18H17ClN2O2/c1-18(2,3)16(22)13(10-20)8-12-7-11-9-14(23-4)5-6-15(11)21-17(12)19/h5-9H,1-4H3 |
| InChIKey | GMOXGMSMQKTFSG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|