C23H14ClN5OS — CID 71597146
2-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-6-phenylsulfanylpyridine-3,5-dicarbonitrile (PubChem CID 71597146) has the molecular formula C23H14ClN5OS and a molecular weight of 443.92 g/mol. Its IUPAC name is 2-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-6-phenylsulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-6-phenylsulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 71597146 |
| Molecular Formula | C23H14ClN5OS |
| Molecular Weight | 443.92 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 2-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-6-phenylsulfanylpyridine-3,5-dicarbonitrile |
| SMILES | COc1ccc2nc(Cl)c(-c3c(C#N)c(N)nc(Sc4ccccc4)c3C#N)cc2c1 |
| InChI | InChI=1S/C23H14ClN5OS/c1-30-14-7-8-19-13(9-14)10-16(21(24)28-19)20-17(11-25)22(27)29-23(18(20)12-26)31-15-5-3-2-4-6-15/h2-10H,1H3,(H2,27,29) |
| InChIKey | APZJMVJPRKSXQE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.92 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|