C20H12N4OS — CID 154585292
2-amino-4-benzoyl-6-phenylsulfanylpyridine-3,5-dicarbonitrile (PubChem CID 154585292) has the molecular formula C20H12N4OS and a molecular weight of 356.41 g/mol. Its IUPAC name is 2-amino-4-benzoyl-6-phenylsulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-benzoyl-6-phenylsulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 154585292 |
| Molecular Formula | C20H12N4OS |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-amino-4-benzoyl-6-phenylsulfanylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(Sc2ccccc2)c(C#N)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H12N4OS/c21-11-15-17(18(25)13-7-3-1-4-8-13)16(12-22)20(24-19(15)23)26-14-9-5-2-6-10-14/h1-10H,(H2,23,24) |
| InChIKey | HIBDYJHLKYFUCF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |