C13H8N4S — CID 11615787
2-amino-6-phenylsulfanylpyridine-3,5-dicarbonitrile (PubChem CID 11615787) has the molecular formula C13H8N4S and a molecular weight of 252.30 g/mol. Its IUPAC name is 2-amino-6-phenylsulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-phenylsulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 11615787 |
| Molecular Formula | C13H8N4S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-amino-6-phenylsulfanylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)c(Sc2ccccc2)nc1N |
| InChI | InChI=1S/C13H8N4S/c14-7-9-6-10(8-15)13(17-12(9)16)18-11-4-2-1-3-5-11/h1-6H,(H2,16,17) |
| InChIKey | ABNQPWCYENJWBT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |