C13H16N4S — CID 5037576
2-amino-6-hexylsulfanylpyridine-3,5-dicarbonitrile (PubChem CID 5037576) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 2-amino-6-hexylsulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-hexylsulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 5037576 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-amino-6-hexylsulfanylpyridine-3,5-dicarbonitrile |
| SMILES | CCCCCCSc1nc(N)c(C#N)cc1C#N |
| InChI | InChI=1S/C13H16N4S/c1-2-3-4-5-6-18-13-11(9-15)7-10(8-14)12(16)17-13/h7H,2-6H2,1H3,(H2,16,17) |
| InChIKey | ORIUILDMEDMGMQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|