C15H20N4OS — CID 44615890
2-amino-6-[4-[(2-methylpropan-2-yl)oxy]butylsulfanyl]pyridine-3,5-dicarbonitrile (PubChem CID 44615890) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-amino-6-[4-[(2-methylpropan-2-yl)oxy]butylsulfanyl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-[4-[(2-methylpropan-2-yl)oxy]butylsulfanyl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 44615890 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-amino-6-[4-[(2-methylpropan-2-yl)oxy]butylsulfanyl]pyridine-3,5-dicarbonitrile |
| SMILES | CC(C)(C)OCCCCSc1nc(N)c(C#N)cc1C#N |
| InChI | InChI=1S/C15H20N4OS/c1-15(2,3)20-6-4-5-7-21-14-12(10-17)8-11(9-16)13(18)19-14/h8H,4-7H2,1-3H3,(H2,18,19) |
| InChIKey | STCCYBVFCNHZPQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|