C19H21ClN2O3 — CID 110190831
ethyl 2-amino-6-tert-butyl-4-(3-chlorophenyl)-5-cyano-4H-pyran-3-carboxylate (PubChem CID 110190831) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is ethyl 2-amino-6-tert-butyl-4-(3-chlorophenyl)-5-cyano-4H-pyran-3-carboxylate.
| Compound Name | ethyl 2-amino-6-tert-butyl-4-(3-chlorophenyl)-5-cyano-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 110190831 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | ethyl 2-amino-6-tert-butyl-4-(3-chlorophenyl)-5-cyano-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)OC(C(C)(C)C)=C(C#N)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-5-24-18(23)15-14(11-7-6-8-12(20)9-11)13(10-21)16(19(2,3)4)25-17(15)22/h6-9,14H,5,22H2,1-4H3 |
| InChIKey | VLUUYKNXEZRMKB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |