C18H21N3O3 — CID 110193135
ethyl 2-amino-6-tert-butyl-5-cyano-4-pyridin-4-yl-4H-pyran-3-carboxylate (PubChem CID 110193135) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl 2-amino-6-tert-butyl-5-cyano-4-pyridin-4-yl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 2-amino-6-tert-butyl-5-cyano-4-pyridin-4-yl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 110193135 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | ethyl 2-amino-6-tert-butyl-5-cyano-4-pyridin-4-yl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)OC(C(C)(C)C)=C(C#N)C1c1ccncc1 |
| InChI | InChI=1S/C18H21N3O3/c1-5-23-17(22)14-13(11-6-8-21-9-7-11)12(10-19)15(18(2,3)4)24-16(14)20/h6-9,13H,5,20H2,1-4H3 |
| InChIKey | QGPSJVSPXVUZAH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |