C18H19N3O5 — CID 3241678
ethyl 2-amino-5-cyano-6-(2-ethoxy-2-oxoethyl)-4-pyridin-3-yl-4H-pyran-3-carboxylate (PubChem CID 3241678) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is ethyl 2-amino-5-cyano-6-(2-ethoxy-2-oxoethyl)-4-pyridin-3-yl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 2-amino-5-cyano-6-(2-ethoxy-2-oxoethyl)-4-pyridin-3-yl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 3241678 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | ethyl 2-amino-5-cyano-6-(2-ethoxy-2-oxoethyl)-4-pyridin-3-yl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)CC1=C(C#N)C(c2cccnc2)C(C(=O)OCC)=C(N)O1 |
| InChI | InChI=1S/C18H19N3O5/c1-3-24-14(22)8-13-12(9-19)15(11-6-5-7-21-10-11)16(17(20)26-13)18(23)25-4-2/h5-7,10,15H,3-4,8,20H2,1-2H3 |
| InChIKey | DNBKYYNDOFWJRK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |