C15H15N3O4 — CID 902354
methyl (4R)-2-amino-5-cyano-6-(methoxymethyl)-4-pyridin-3-yl-4H-pyran-3-carboxylate (PubChem CID 902354) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is methyl (4R)-2-amino-5-cyano-6-(methoxymethyl)-4-pyridin-3-yl-4H-pyran-3-carboxylate.
| Compound Name | methyl (4R)-2-amino-5-cyano-6-(methoxymethyl)-4-pyridin-3-yl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 902354 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | methyl (4R)-2-amino-5-cyano-6-(methoxymethyl)-4-pyridin-3-yl-4H-pyran-3-carboxylate |
| SMILES | COCC1=C(C#N)[C@@H](c2cccnc2)C(C(=O)OC)=C(N)O1 |
| InChI | InChI=1S/C15H15N3O4/c1-20-8-11-10(6-16)12(9-4-3-5-18-7-9)13(14(17)22-11)15(19)21-2/h3-5,7,12H,8,17H2,1-2H3/t12-/m1/s1 |
| InChIKey | GTCDQIGGGHBYSU-GFCCVEGCSA-N |
| XLogP | 0.96 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |