C15H15N3O3 — CID 610135
5-cyano-6-ethoxy-2-methyl-4-pyridin-4-yl-4H-pyran-3-carboxamide (PubChem CID 610135) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 5-cyano-6-ethoxy-2-methyl-4-pyridin-4-yl-4H-pyran-3-carboxamide.
| Compound Name | 5-cyano-6-ethoxy-2-methyl-4-pyridin-4-yl-4H-pyran-3-carboxamide |
|---|---|
| PubChem CID | 610135 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-cyano-6-ethoxy-2-methyl-4-pyridin-4-yl-4H-pyran-3-carboxamide |
| SMILES | CCOC1=C(C#N)C(c2ccncc2)C(C(N)=O)=C(C)O1 |
| InChI | InChI=1S/C15H15N3O3/c1-3-20-15-11(8-16)13(10-4-6-18-7-5-10)12(14(17)19)9(2)21-15/h4-7,13H,3H2,1-2H3,(H2,17,19) |
| InChIKey | YNSLGKKHRHIYEA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |