C21H24N2O3Si — CID 169390432
ethyl 6-amino-5-cyano-2-methyl-4-[4-(2-trimethylsilylethynyl)phenyl]-4H-pyran-3-carboxylate (PubChem CID 169390432) has the molecular formula C21H24N2O3Si and a molecular weight of 380.52 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-2-methyl-4-[4-(2-trimethylsilylethynyl)phenyl]-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-2-methyl-4-[4-(2-trimethylsilylethynyl)phenyl]-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390432 |
| Molecular Formula | C21H24N2O3Si |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | ethyl 6-amino-5-cyano-2-methyl-4-[4-(2-trimethylsilylethynyl)phenyl]-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C21H24N2O3Si/c1-6-25-21(24)18-14(2)26-20(23)17(13-22)19(18)16-9-7-15(8-10-16)11-12-27(3,4)5/h7-10,19H,6,23H2,1-5H3 |
| InChIKey | NFQKXHQKVZJPHY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|