C24H32N2O4 — CID 169390401
ethyl 6-amino-5-cyano-2-methyl-4-(4-octoxyphenyl)-4H-pyran-3-carboxylate (PubChem CID 169390401) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-2-methyl-4-(4-octoxyphenyl)-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-2-methyl-4-(4-octoxyphenyl)-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390401 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | ethyl 6-amino-5-cyano-2-methyl-4-(4-octoxyphenyl)-4H-pyran-3-carboxylate |
| SMILES | CCCCCCCCOc1ccc(C2C(C#N)=C(N)OC(C)=C2C(=O)OCC)cc1 |
| InChI | InChI=1S/C24H32N2O4/c1-4-6-7-8-9-10-15-29-19-13-11-18(12-14-19)22-20(16-25)23(26)30-17(3)21(22)24(27)28-5-2/h11-14,22H,4-10,15,26H2,1-3H3 |
| InChIKey | NVKFMKKUSQHPMT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|