C22H28N2O4 — CID 169390724
ethyl 6-amino-5-cyano-2-methyl-4-(5-methyl-2-pentoxyphenyl)-4H-pyran-3-carboxylate (PubChem CID 169390724) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-2-methyl-4-(5-methyl-2-pentoxyphenyl)-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-2-methyl-4-(5-methyl-2-pentoxyphenyl)-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390724 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | ethyl 6-amino-5-cyano-2-methyl-4-(5-methyl-2-pentoxyphenyl)-4H-pyran-3-carboxylate |
| SMILES | CCCCCOc1ccc(C)cc1C1C(C#N)=C(N)OC(C)=C1C(=O)OCC |
| InChI | InChI=1S/C22H28N2O4/c1-5-7-8-11-27-18-10-9-14(3)12-16(18)20-17(13-23)21(24)28-15(4)19(20)22(25)26-6-2/h9-10,12,20H,5-8,11,24H2,1-4H3 |
| InChIKey | VNAAZUHIFLGZMB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|