C22H27FN2O4 — CID 169390955
ethyl 6-amino-5-cyano-4-[4-fluoro-2-(pentoxymethyl)phenyl]-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169390955) has the molecular formula C22H27FN2O4 and a molecular weight of 402.47 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-4-[4-fluoro-2-(pentoxymethyl)phenyl]-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-4-[4-fluoro-2-(pentoxymethyl)phenyl]-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390955 |
| Molecular Formula | C22H27FN2O4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | ethyl 6-amino-5-cyano-4-[4-fluoro-2-(pentoxymethyl)phenyl]-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCCCCOCc1cc(F)ccc1C1C(C#N)=C(N)OC(C)=C1C(=O)OCC |
| InChI | InChI=1S/C22H27FN2O4/c1-4-6-7-10-27-13-15-11-16(23)8-9-17(15)20-18(12-24)21(25)29-14(3)19(20)22(26)28-5-2/h8-9,11,20H,4-7,10,13,25H2,1-3H3 |
| InChIKey | VVSAIEVBQAQGOA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|