C17H16BrFN2O3 — CID 169392820
ethyl 6-amino-4-[2-(bromomethyl)-4-fluorophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169392820) has the molecular formula C17H16BrFN2O3 and a molecular weight of 395.23 g/mol. Its IUPAC name is ethyl 6-amino-4-[2-(bromomethyl)-4-fluorophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-4-[2-(bromomethyl)-4-fluorophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169392820 |
| Molecular Formula | C17H16BrFN2O3 |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | ethyl 6-amino-4-[2-(bromomethyl)-4-fluorophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(F)cc1CBr |
| InChI | InChI=1S/C17H16BrFN2O3/c1-3-23-17(22)14-9(2)24-16(21)13(8-20)15(14)12-5-4-11(19)6-10(12)7-18/h4-6,15H,3,7,21H2,1-2H3 |
| InChIKey | HAKOHLIYUHNECO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|