C20H22F2N2O4 — CID 169390695
ethyl 6-amino-4-(3-butoxy-4,5-difluorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169390695) has the molecular formula C20H22F2N2O4 and a molecular weight of 392.40 g/mol. Its IUPAC name is ethyl 6-amino-4-(3-butoxy-4,5-difluorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-4-(3-butoxy-4,5-difluorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390695 |
| Molecular Formula | C20H22F2N2O4 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | ethyl 6-amino-4-(3-butoxy-4,5-difluorophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCCCOc1cc(C2C(C#N)=C(N)OC(C)=C2C(=O)OCC)cc(F)c1F |
| InChI | InChI=1S/C20H22F2N2O4/c1-4-6-7-27-15-9-12(8-14(21)18(15)22)17-13(10-23)19(24)28-11(3)16(17)20(25)26-5-2/h8-9,17H,4-7,24H2,1-3H3 |
| InChIKey | XRZCDPPHABRPKE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|