C14H17ClN2O2S — CID 141365565
ethyl 4-(3-chlorophenyl)-6-methyl-2-sulfanyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate (PubChem CID 141365565) has the molecular formula C14H17ClN2O2S and a molecular weight of 312.82 g/mol. Its IUPAC name is ethyl 4-(3-chlorophenyl)-6-methyl-2-sulfanyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(3-chlorophenyl)-6-methyl-2-sulfanyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 141365565 |
| Molecular Formula | C14H17ClN2O2S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | ethyl 4-(3-chlorophenyl)-6-methyl-2-sulfanyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(S)NC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H17ClN2O2S/c1-3-19-13(18)11-8(2)16-14(20)17-12(11)9-5-4-6-10(15)7-9/h4-7,12,14,16-17,20H,3H2,1-2H3 |
| InChIKey | WZGCTISORQNIQU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|