C10H9ClN2O2 — CID 98170662
(3S)-1-amino-3-(3-chlorophenyl)pyrrolidine-2,5-dione (PubChem CID 98170662) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is (3S)-1-amino-3-(3-chlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-amino-3-(3-chlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98170662 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (3S)-1-amino-3-(3-chlorophenyl)pyrrolidine-2,5-dione |
| SMILES | NN1C(=O)C[C@@H](c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C10H9ClN2O2/c11-7-3-1-2-6(4-7)8-5-9(14)13(12)10(8)15/h1-4,8H,5,12H2/t8-/m0/s1 |
| InChIKey | XZEKJPZKBUAPIX-QMMMGPOBSA-N |
| XLogP | 1.06 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|