C22H15ClN2O3 — CID 19754764
N-(3-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-phenylacetamide (PubChem CID 19754764) has the molecular formula C22H15ClN2O3 and a molecular weight of 390.83 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-phenylacetamide.
| Compound Name | N-(3-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 19754764 |
| Molecular Formula | C22H15ClN2O3 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-(3-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-phenylacetamide |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N(c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H15ClN2O3/c23-15-7-6-10-17(13-15)25(16-8-2-1-3-9-16)20(26)14-24-21(27)18-11-4-5-12-19(18)22(24)28/h1-13H,14H2 |
| InChIKey | RUNAQTJMANPYNC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|