C7H9ClNNaO3S — CID 174536011
sodium;(6R)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid;hydride (PubChem CID 174536011) has the molecular formula C7H9ClNNaO3S and a molecular weight of 245.66 g/mol. Its IUPAC name is sodium;(6R)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid;hydride.
| Compound Name | sodium;(6R)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid;hydride |
|---|---|
| PubChem CID | 174536011 |
| Molecular Formula | C7H9ClNNaO3S |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | sodium;(6R)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid;hydride |
| SMILES | O=C1C[C@H]2SCC(Cl)(C(=O)O)CN12.[H-].[Na+] |
| InChI | InChI=1S/C7H8ClNO3S.Na.H/c8-7(6(11)12)2-9-4(10)1-5(9)13-3-7;;/h5H,1-3H2,(H,11,12);;/q;+1;-1/t5-,7?;;/m1../s1 |
| InChIKey | JVOOFZFSRWGDLB-WZQQPJKESA-N |
| XLogP | -2.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|