C11H17NO3S — CID 70478996
(5R)-7-oxo-3-pentyl-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid (PubChem CID 70478996) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is (5R)-7-oxo-3-pentyl-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid.
| Compound Name | (5R)-7-oxo-3-pentyl-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 70478996 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (5R)-7-oxo-3-pentyl-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
| SMILES | CCCCCC1(C(=O)O)CN2C(=O)C[C@H]2S1 |
| InChI | InChI=1S/C11H17NO3S/c1-2-3-4-5-11(10(14)15)7-12-8(13)6-9(12)16-11/h9H,2-7H2,1H3,(H,14,15)/t9-,11?/m1/s1 |
| InChIKey | SBWLBFTUYREUNG-BFHBGLAWSA-N |
| XLogP | 1.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|