C13H13ClN3O2S+ — CID 166639117
(6S,7R)-7-amino-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride (PubChem CID 166639117) has the molecular formula C13H13ClN3O2S+ and a molecular weight of 310.79 g/mol. Its IUPAC name is (6S,7R)-7-amino-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride.
| Compound Name | (6S,7R)-7-amino-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride |
|---|---|
| PubChem CID | 166639117 |
| Molecular Formula | C13H13ClN3O2S+ |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | (6S,7R)-7-amino-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride |
| SMILES | N[C@@H]1C(=O)N2C(C(=O)Cl)=C(C[n+]3ccccc3)CS[C@@H]12 |
| InChI | InChI=1S/C13H13ClN3O2S/c14-11(18)10-8(6-16-4-2-1-3-5-16)7-20-13-9(15)12(19)17(10)13/h1-5,9,13H,6-7,15H2/q+1/t9-,13+/m1/s1 |
| InChIKey | VFBRXMHNVUQICW-RNCFNFMXSA-N |
| XLogP | 0.24 |
| TPSA | 67.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|