C16H15N4O4S+ — CID 70426615
(6S,7R)-7-amino-3-[[4-(1,3-oxazol-5-yl)pyridin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 70426615) has the molecular formula C16H15N4O4S+ and a molecular weight of 359.39 g/mol. Its IUPAC name is (6S,7R)-7-amino-3-[[4-(1,3-oxazol-5-yl)pyridin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-7-amino-3-[[4-(1,3-oxazol-5-yl)pyridin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70426615 |
| Molecular Formula | C16H15N4O4S+ |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (6S,7R)-7-amino-3-[[4-(1,3-oxazol-5-yl)pyridin-1-ium-1-yl]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | N[C@@H]1C(=O)N2C(C(=O)O)=C(C[n+]3ccc(-c4cnco4)cc3)CS[C@@H]12 |
| InChI | InChI=1S/C16H14N4O4S/c17-12-14(21)20-13(16(22)23)10(7-25-15(12)20)6-19-3-1-9(2-4-19)11-5-18-8-24-11/h1-5,8,12,15H,6-7,17H2/p+1/t12-,15+/m1/s1 |
| InChIKey | MCSWXROCYIXXJS-DOMZBBRYSA-O |
| XLogP | 0.21 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|