C8H8BrClN2O2S — CID 54124392
(6S,7R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride (PubChem CID 54124392) has the molecular formula C8H8BrClN2O2S and a molecular weight of 311.59 g/mol. Its IUPAC name is (6S,7R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride.
| Compound Name | (6S,7R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride |
|---|---|
| PubChem CID | 54124392 |
| Molecular Formula | C8H8BrClN2O2S |
| Molecular Weight | 311.59 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | (6S,7R)-7-amino-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride |
| SMILES | N[C@@H]1C(=O)N2C(C(=O)Cl)=C(CBr)CS[C@@H]12 |
| InChI | InChI=1S/C8H8BrClN2O2S/c9-1-3-2-15-8-4(11)7(14)12(8)5(3)6(10)13/h4,8H,1-2,11H2/t4-,8+/m1/s1 |
| InChIKey | NPYGKIKWHKBIGY-VHWMUFPASA-N |
| XLogP | 0.64 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.59 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|