C13H19ClN3O2S+ — CID 91281473
3-[(6R,7R)-7-amino-2-carbonochloridoyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]prop-2-enyl-trimethylazanium (PubChem CID 91281473) has the molecular formula C13H19ClN3O2S+ and a molecular weight of 316.83 g/mol. Its IUPAC name is 3-[(6R,7R)-7-amino-2-carbonochloridoyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]prop-2-enyl-trimethylazanium.
| Compound Name | 3-[(6R,7R)-7-amino-2-carbonochloridoyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]prop-2-enyl-trimethylazanium |
|---|---|
| PubChem CID | 91281473 |
| Molecular Formula | C13H19ClN3O2S+ |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-[(6R,7R)-7-amino-2-carbonochloridoyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]prop-2-enyl-trimethylazanium |
| SMILES | C[N+](C)(C)CC=CC1=C(C(=O)Cl)N2C(=O)[C@@H](N)[C@H]2SC1 |
| InChI | InChI=1S/C13H19ClN3O2S/c1-17(2,3)6-4-5-8-7-20-13-9(15)12(19)16(13)10(8)11(14)18/h4-5,9,13H,6-7,15H2,1-3H3/q+1/t9-,13-/m1/s1 |
| InChIKey | JABUBMPXHMAOPL-NOZJJQNGSA-N |
| XLogP | 0.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|