C11H13BClN2O3PS — CID 159601700
CID 159601700 (PubChem CID 159601700) has the molecular formula C11H13BClN2O3PS and a molecular weight of 330.54 g/mol.
| Compound Name | CID 159601700 |
|---|---|
| PubChem CID | 159601700 |
| Molecular Formula | C11H13BClN2O3PS |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | — |
| SMILES | [B]P(C)OC(=O)C1=C(/C=C/CCl)CSC2[C@H](N)C(=O)N12 |
| InChI | InChI=1S/C11H13BClN2O3PS/c1-19(12)18-11(17)8-6(3-2-4-13)5-20-10-7(14)9(16)15(8)10/h2-3,7,10H,4-5,14H2,1H3/b3-2+/t7-,10?,19?/m1/s1 |
| InChIKey | BMYHZYKSFUBBLK-URSLHVLGSA-N |
| XLogP | 0.93 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|