C15H15ClN3O2S+ — CID 57151557
(6R,7R)-7-amino-8-oxo-3-(3-pyridin-1-ium-1-ylprop-1-enyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride (PubChem CID 57151557) has the molecular formula C15H15ClN3O2S+ and a molecular weight of 336.82 g/mol. Its IUPAC name is (6R,7R)-7-amino-8-oxo-3-(3-pyridin-1-ium-1-ylprop-1-enyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride.
| Compound Name | (6R,7R)-7-amino-8-oxo-3-(3-pyridin-1-ium-1-ylprop-1-enyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride |
|---|---|
| PubChem CID | 57151557 |
| Molecular Formula | C15H15ClN3O2S+ |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | (6R,7R)-7-amino-8-oxo-3-(3-pyridin-1-ium-1-ylprop-1-enyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl chloride |
| SMILES | N[C@@H]1C(=O)N2C(C(=O)Cl)=C(C=CC[n+]3ccccc3)CS[C@H]12 |
| InChI | InChI=1S/C15H15ClN3O2S/c16-13(20)12-10(5-4-8-18-6-2-1-3-7-18)9-22-15-11(17)14(21)19(12)15/h1-7,11,15H,8-9,17H2/q+1/t11-,15-/m1/s1 |
| InChIKey | RHIODNHJZSOPNY-IAQYHMDHSA-N |
| XLogP | 0.79 |
| TPSA | 67.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|