C16H13Br2N5O6S2 — CID 56613830
(6S)-3-(2,2-dibromoethenyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid (PubChem CID 56613830) has the molecular formula C16H13Br2N5O6S2 and a molecular weight of 595.25 g/mol. Its IUPAC name is (6S)-3-(2,2-dibromoethenyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid.
| Compound Name | (6S)-3-(2,2-dibromoethenyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56613830 |
| Molecular Formula | C16H13Br2N5O6S2 |
| Molecular Weight | 595.25 g/mol |
| Exact Mass | 592.87 |
| IUPAC Name | (6S)-3-(2,2-dibromoethenyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)C(C=C(Br)Br)=CS[C@@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C16H13Br2N5O6S2/c1-29-22-9(7-4-31-16(20-7)19-5-24)12(25)21-10-13(26)23-11(15(27)28)6(2-8(17)18)3-30-14(10)23/h2-5,10-11,14H,1H3,(H,21,25)(H,27,28)(H,19,20,24)/t10?,11?,14-/m0/s1 |
| InChIKey | WXDLXDZPISRMLE-MGULZYLOSA-N |
| XLogP | 1.43 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|