C10H10N8O7S2 — CID 56633955
(2S,3S)-2-azido-3-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 56633955) has the molecular formula C10H10N8O7S2 and a molecular weight of 418.37 g/mol. Its IUPAC name is (2S,3S)-2-azido-3-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3S)-2-azido-3-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 56633955 |
| Molecular Formula | C10H10N8O7S2 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | (2S,3S)-2-azido-3-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)[C@@H]1N=[N+]=[N-])c1csc(NC=O)n1 |
| InChI | InChI=1S/C10H10N8O7S2/c1-25-16-5(4-2-26-10(13-4)12-3-19)8(20)14-6-7(15-17-11)18(9(6)21)27(22,23)24/h2-3,6-7H,1H3,(H,14,20)(H,12,13,19)(H,22,23,24)/t6-,7-/m0/s1 |
| InChIKey | GWHVDBIQPPEMNB-BQBZGAKWSA-N |
| XLogP | -1.17 |
| TPSA | 216.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|