C10H10N8O4S — CID 54438705
N-[(2R,3S)-2-azido-4-oxoazetidin-3-yl]-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetamide (PubChem CID 54438705) has the molecular formula C10H10N8O4S and a molecular weight of 338.31 g/mol. Its IUPAC name is N-[(2R,3S)-2-azido-4-oxoazetidin-3-yl]-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetamide.
| Compound Name | N-[(2R,3S)-2-azido-4-oxoazetidin-3-yl]-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetamide |
|---|---|
| PubChem CID | 54438705 |
| Molecular Formula | C10H10N8O4S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-[(2R,3S)-2-azido-4-oxoazetidin-3-yl]-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetamide |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N[C@@H]1N=[N+]=[N-])c1csc(NC=O)n1 |
| InChI | InChI=1S/C10H10N8O4S/c1-22-17-5(4-2-23-10(13-4)12-3-19)8(20)14-6-7(16-18-11)15-9(6)21/h2-3,6-7H,1H3,(H,14,20)(H,15,21)(H,12,13,19)/t6-,7+/m0/s1 |
| InChIKey | WMOFSBKLSPNWET-NKWVEPMBSA-N |
| XLogP | -0.69 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|