C23H31N5O8S2 — CID 173422368
1,3-di(propan-2-yloxy)propan-2-yl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate (PubChem CID 173422368) has the molecular formula C23H31N5O8S2 and a molecular weight of 569.66 g/mol. Its IUPAC name is 1,3-di(propan-2-yloxy)propan-2-yl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate.
| Compound Name | 1,3-di(propan-2-yloxy)propan-2-yl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
|---|---|
| PubChem CID | 173422368 |
| Molecular Formula | C23H31N5O8S2 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | 1,3-di(propan-2-yloxy)propan-2-yl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C=CC(C(=O)OC(COC(C)C)COC(C)C)S[C@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C23H31N5O8S2/c1-12(2)34-8-14(9-35-13(3)4)36-22(32)16-6-7-28-20(31)18(21(28)38-16)26-19(30)17(27-33-5)15-10-37-23(25-15)24-11-29/h6-7,10-14,16,18,21H,8-9H2,1-5H3,(H,26,30)(H,24,25,29)/t16?,18?,21-/m1/s1 |
| InChIKey | NCIFLZRCNMRYOO-QYGXFBIXSA-N |
| XLogP | 1.11 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|