C13H15ClN8O7S2 — CID 158524663
(3S)-2-azido-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 158524663) has the molecular formula C13H15ClN8O7S2 and a molecular weight of 494.90 g/mol. Its IUPAC name is (3S)-2-azido-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (3S)-2-azido-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 158524663 |
| Molecular Formula | C13H15ClN8O7S2 |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | (3S)-2-azido-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CC(C)ON=C(C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)C1N=[N+]=[N-])c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C13H15ClN8O7S2/c1-5(2)29-20-8(6-4-30-13(16-6)17-7(23)3-14)11(24)18-9-10(19-21-15)22(12(9)25)31(26,27)28/h4-5,9-10H,3H2,1-2H3,(H,18,24)(H,16,17,23)(H,26,27,28)/t9-,10?/m0/s1 |
| InChIKey | GVAPPSRYXIZQSZ-RGURZIINSA-N |
| XLogP | 0.22 |
| TPSA | 216.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|